C21H24N2O — CID 14265720
2-(1,3-diazepan-2-ylidene)-1-(4-methylphenyl)-3-phenylpropan-1-one (PubChem CID 14265720) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-(1,3-diazepan-2-ylidene)-1-(4-methylphenyl)-3-phenylpropan-1-one.
| Compound Name | 2-(1,3-diazepan-2-ylidene)-1-(4-methylphenyl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 14265720 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-(1,3-diazepan-2-ylidene)-1-(4-methylphenyl)-3-phenylpropan-1-one |
| SMILES | Cc1ccc(C(=O)C(Cc2ccccc2)=C2NCCCCN2)cc1 |
| InChI | InChI=1S/C21H24N2O/c1-16-9-11-18(12-10-16)20(24)19(15-17-7-3-2-4-8-17)21-22-13-5-6-14-23-21/h2-4,7-12,22-23H,5-6,13-15H2,1H3 |
| InChIKey | AWLQWIRYNGHYAG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|