C22H26N2O — CID 14265721
2-(1,3-diazepan-2-ylidene)-1-(2,4-dimethylphenyl)-3-phenylpropan-1-one (PubChem CID 14265721) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(1,3-diazepan-2-ylidene)-1-(2,4-dimethylphenyl)-3-phenylpropan-1-one.
| Compound Name | 2-(1,3-diazepan-2-ylidene)-1-(2,4-dimethylphenyl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 14265721 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-(1,3-diazepan-2-ylidene)-1-(2,4-dimethylphenyl)-3-phenylpropan-1-one |
| SMILES | Cc1ccc(C(=O)C(Cc2ccccc2)=C2NCCCCN2)c(C)c1 |
| InChI | InChI=1S/C22H26N2O/c1-16-10-11-19(17(2)14-16)21(25)20(15-18-8-4-3-5-9-18)22-23-12-6-7-13-24-22/h3-5,8-11,14,23-24H,6-7,12-13,15H2,1-2H3 |
| InChIKey | OJXJTZYZTUWGEN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|