C17H9F3IN3 — CID 142659216
4-(2-iodophenyl)-3-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile (PubChem CID 142659216) has the molecular formula C17H9F3IN3 and a molecular weight of 439.18 g/mol. Its IUPAC name is 4-(2-iodophenyl)-3-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile.
| Compound Name | 4-(2-iodophenyl)-3-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 142659216 |
| Molecular Formula | C17H9F3IN3 |
| Molecular Weight | 439.18 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 4-(2-iodophenyl)-3-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccccc2I)c(-n2cc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C17H9F3IN3/c18-17(19,20)12-9-23-24(10-12)16-7-11(8-22)5-6-14(16)13-3-1-2-4-15(13)21/h1-7,9-10H |
| InChIKey | XWTVLHCALKGHQT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.18 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|