C12H5F6N3O — CID 167329126
4-hydroxy-3-(trifluoromethyl)-5-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile (PubChem CID 167329126) has the molecular formula C12H5F6N3O and a molecular weight of 321.18 g/mol. Its IUPAC name is 4-hydroxy-3-(trifluoromethyl)-5-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile.
| Compound Name | 4-hydroxy-3-(trifluoromethyl)-5-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 167329126 |
| Molecular Formula | C12H5F6N3O |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-hydroxy-3-(trifluoromethyl)-5-[4-(trifluoromethyl)pyrazol-1-yl]benzonitrile |
| SMILES | N#Cc1cc(-n2cc(C(F)(F)F)cn2)c(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H5F6N3O/c13-11(14,15)7-4-20-21(5-7)9-2-6(3-19)1-8(10(9)22)12(16,17)18/h1-2,4-5,22H |
| InChIKey | RTWLMFUJJTXHCK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |