C12H14F8O — CID 142659696
(Z)-4,4,5,5,6,6,7,7-octafluoro-3-[(E)-prop-1-enoxy]non-2-ene (PubChem CID 142659696) has the molecular formula C12H14F8O and a molecular weight of 326.23 g/mol. Its IUPAC name is (Z)-4,4,5,5,6,6,7,7-octafluoro-3-[(E)-prop-1-enoxy]non-2-ene.
| Compound Name | (Z)-4,4,5,5,6,6,7,7-octafluoro-3-[(E)-prop-1-enoxy]non-2-ene |
|---|---|
| PubChem CID | 142659696 |
| Molecular Formula | C12H14F8O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (Z)-4,4,5,5,6,6,7,7-octafluoro-3-[(E)-prop-1-enoxy]non-2-ene |
| SMILES | C/C=C(\O/C=C/C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC |
| InChI | InChI=1S/C12H14F8O/c1-4-7-21-8(5-2)10(15,16)12(19,20)11(17,18)9(13,14)6-3/h4-5,7H,6H2,1-3H3/b7-4+,8-5- |
| InChIKey | FZFWTEIKRHKZJK-NIQPXEJBSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|