C11H14F6O — CID 142659701
(Z)-5,5,6,6,7,7-hexafluoro-3-[(E)-prop-1-enoxy]oct-2-ene (PubChem CID 142659701) has the molecular formula C11H14F6O and a molecular weight of 276.22 g/mol. Its IUPAC name is (Z)-5,5,6,6,7,7-hexafluoro-3-[(E)-prop-1-enoxy]oct-2-ene.
| Compound Name | (Z)-5,5,6,6,7,7-hexafluoro-3-[(E)-prop-1-enoxy]oct-2-ene |
|---|---|
| PubChem CID | 142659701 |
| Molecular Formula | C11H14F6O |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (Z)-5,5,6,6,7,7-hexafluoro-3-[(E)-prop-1-enoxy]oct-2-ene |
| SMILES | C/C=C(/CC(F)(F)C(F)(F)C(C)(F)F)O/C=C/C |
| InChI | InChI=1S/C11H14F6O/c1-4-6-18-8(5-2)7-10(14,15)11(16,17)9(3,12)13/h4-6H,7H2,1-3H3/b6-4+,8-5- |
| InChIKey | PZWKCCWYTKWCKL-NDWVUGOJSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|