C10H7F9O — CID 59259645
1-but-3-enoxy-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene (PubChem CID 59259645) has the molecular formula C10H7F9O and a molecular weight of 314.15 g/mol. Its IUPAC name is 1-but-3-enoxy-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene.
| Compound Name | 1-but-3-enoxy-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene |
|---|---|
| PubChem CID | 59259645 |
| Molecular Formula | C10H7F9O |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1-but-3-enoxy-2,3,3,4,4,5,5,6,6-nonafluorocyclohexene |
| SMILES | C=CCCOC1=C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H7F9O/c1-2-3-4-20-6-5(11)7(12,13)9(16,17)10(18,19)8(6,14)15/h2H,1,3-4H2 |
| InChIKey | UWPGECFSZDOPPT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|