C10H4F14O2 — CID 155670464
3,3,4,4,5,5,6,6-octafluoro-1,2-bis(2,2,2-trifluoroethoxy)cyclohexene (PubChem CID 155670464) has the molecular formula C10H4F14O2 and a molecular weight of 422.11 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(2,2,2-trifluoroethoxy)cyclohexene.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(2,2,2-trifluoroethoxy)cyclohexene |
|---|---|
| PubChem CID | 155670464 |
| Molecular Formula | C10H4F14O2 |
| Molecular Weight | 422.11 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(2,2,2-trifluoroethoxy)cyclohexene |
| SMILES | FC(F)(F)COC1=C(OCC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H4F14O2/c11-5(12,13)1-25-3-4(26-2-6(14,15)16)8(19,20)10(23,24)9(21,22)7(3,17)18/h1-2H2 |
| InChIKey | BJDLASDNHHGWDN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.11 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|