C11H6F14O2 — CID 155670595
3,3,4,4,5,5-hexafluoro-1,2-bis(2,2,3,3-tetrafluoropropoxy)cyclopentene (PubChem CID 155670595) has the molecular formula C11H6F14O2 and a molecular weight of 436.14 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-bis(2,2,3,3-tetrafluoropropoxy)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(2,2,3,3-tetrafluoropropoxy)cyclopentene |
|---|---|
| PubChem CID | 155670595 |
| Molecular Formula | C11H6F14O2 |
| Molecular Weight | 436.14 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(2,2,3,3-tetrafluoropropoxy)cyclopentene |
| SMILES | FC(F)C(F)(F)COC1=C(OCC(F)(F)C(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H6F14O2/c12-5(13)7(16,17)1-26-3-4(27-2-8(18,19)6(14)15)10(22,23)11(24,25)9(3,20)21/h5-6H,1-2H2 |
| InChIKey | WMUUFJBKLBEIKH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.14 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|