C7H5F6OY- — CID 147732617
1-ethoxy-3,3,4,4,5,5-hexafluorocyclopentene;yttrium (PubChem CID 147732617) has the molecular formula C7H5F6OY- and a molecular weight of 308.01 g/mol. Its IUPAC name is 1-ethoxy-3,3,4,4,5,5-hexafluorocyclopentene;yttrium.
| Compound Name | 1-ethoxy-3,3,4,4,5,5-hexafluorocyclopentene;yttrium |
|---|---|
| PubChem CID | 147732617 |
| Molecular Formula | C7H5F6OY- |
| Molecular Weight | 308.01 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 1-ethoxy-3,3,4,4,5,5-hexafluorocyclopentene;yttrium |
| SMILES | CCOC1=[C-]C(F)(F)C(F)(F)C1(F)F.[Y] |
| InChI | InChI=1S/C7H5F6O.Y/c1-2-14-4-3-5(8,9)7(12,13)6(4,10)11;/h2H2,1H3;/q-1; |
| InChIKey | WWPIVQQTSKYBFT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.01 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|