C8H4F10O — CID 155670522
3,3,4,4,5,5-hexafluoro-1-(2,2,3,3-tetrafluoropropoxy)cyclopentene (PubChem CID 155670522) has the molecular formula C8H4F10O and a molecular weight of 306.10 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(2,2,3,3-tetrafluoropropoxy)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(2,2,3,3-tetrafluoropropoxy)cyclopentene |
|---|---|
| PubChem CID | 155670522 |
| Molecular Formula | C8H4F10O |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(2,2,3,3-tetrafluoropropoxy)cyclopentene |
| SMILES | FC(F)C(F)(F)COC1=CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H4F10O/c9-4(10)5(11,12)2-19-3-1-6(13,14)8(17,18)7(3,15)16/h1,4H,2H2 |
| InChIKey | FUQYCVATOIILFR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|