About 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene
1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene (PubChem CID 66680850) has the molecular formula C10H12F4O
and a molecular weight of 224.20 g/mol. Its IUPAC name is 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene.
Molecular Properties
| Compound Name | 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene |
| PubChem CID | 66680850 |
| Molecular Formula | C10H12F4O |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene |
| SMILES | C=CCC(OC1=C(F)CCC1)C(F)(F)F |
| InChI | InChI=1S/C10H12F4O/c1-2-4-9(10(12,13)14)15-8-6-3-5-7(8)11/h2,9H,1,3-6H2 |
| InChIKey | UYUOYNFHXVXHJB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene?
The IUPAC name of 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene (CID 66680850) is 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene.
What is the SMILES notation for 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene?
The canonical SMILES for 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene is C=CCC(OC1=C(F)CCC1)C(F)(F)F.
What is the InChIKey of 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene?
The InChIKey is UYUOYNFHXVXHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F4O/c1-2-4-9(10(12,13)14)15-8-6-3-5-7(8)11/h2,9H,1,3-6H2.
What are the key properties of 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene?
1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene has a molecular weight of 224.20 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene is sourced from PubChem (CID 66680850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).