C7H2F10O — CID 155670543
1,3,3,4,4,5,5-heptafluoro-2-(2,2,2-trifluoroethoxy)cyclopentene (PubChem CID 155670543) has the molecular formula C7H2F10O and a molecular weight of 292.07 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-(2,2,2-trifluoroethoxy)cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-(2,2,2-trifluoroethoxy)cyclopentene |
|---|---|
| PubChem CID | 155670543 |
| Molecular Formula | C7H2F10O |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-(2,2,2-trifluoroethoxy)cyclopentene |
| SMILES | FC1=C(OCC(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H2F10O/c8-2-3(18-1-4(9,10)11)6(14,15)7(16,17)5(2,12)13/h1H2 |
| InChIKey | XCAIJQXYINIZQX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|