C12H2F20O2 — CID 155670465
3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexene (PubChem CID 155670465) has the molecular formula C12H2F20O2 and a molecular weight of 558.11 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexene.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexene |
|---|---|
| PubChem CID | 155670465 |
| Molecular Formula | C12H2F20O2 |
| Molecular Weight | 558.11 g/mol |
| Exact Mass | 557.97 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclohexene |
| SMILES | FC(F)(F)C(OC1=C(OC(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H2F20O2/c13-5(14)1(33-3(7(17,18)19)8(20,21)22)2(6(15,16)12(31,32)11(5,29)30)34-4(9(23,24)25)10(26,27)28/h3-4H |
| InChIKey | CKVHGIKRLUIILY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.11 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|