C10H11N3 — CID 142660551
2-methyl-2-prop-1-enylpyrrolo[2,3-d]pyridazine (PubChem CID 142660551) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-methyl-2-prop-1-enylpyrrolo[2,3-d]pyridazine.
| Compound Name | 2-methyl-2-prop-1-enylpyrrolo[2,3-d]pyridazine |
|---|---|
| PubChem CID | 142660551 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-methyl-2-prop-1-enylpyrrolo[2,3-d]pyridazine |
| SMILES | CC=CC1(C)C=c2cnncc2=N1 |
| InChI | InChI=1S/C10H11N3/c1-3-4-10(2)5-8-6-11-12-7-9(8)13-10/h3-7H,1-2H3 |
| InChIKey | OKKFOEPAPGDOJN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|