C39H52FN4NaO7S2 — CID 142661231
sodium (Z)-18-[5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluoro-2-methylsulfonylphenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]octadec-9-enoate (PubChem CID 142661231) has the molecular formula C39H52FN4NaO7S2 and a molecular weight of 794.99 g/mol. Its IUPAC name is sodium (Z)-18-[5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluoro-2-methylsulfonylphenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]octadec-9-enoate.
| Compound Name | sodium (Z)-18-[5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluoro-2-methylsulfonylphenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]octadec-9-enoate |
|---|---|
| PubChem CID | 142661231 |
| Molecular Formula | C39H52FN4NaO7S2 |
| Molecular Weight | 794.99 g/mol |
| Exact Mass | 794.32 |
| IUPAC Name | sodium (Z)-18-[5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluoro-2-methylsulfonylphenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl]octadec-9-enoate |
| SMILES | CS(=O)(=O)c1cc(F)ccc1CNC(=O)c1nc(N2CCCCS2(=O)=O)c2cccnc2c1CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C39H53FN4O7S2.Na/c1-52(48,49)34-28-31(40)24-23-30(34)29-42-39(47)37-32(36-33(21-19-25-41-36)38(43-37)44-26-17-18-27-53(44,50)51)20-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-22-35(45)46;/h2,4,19,21,23-25,28H,3,5-18,20,22,26-27,29H2,1H3,(H,42,47)(H,45,46);/q;+1/p-1/b4-2-; |
| InChIKey | CTMFRFWMVGGWSX-MKHFZPSSSA-M |
| XLogP | 3.35 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.99 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|