C24H26ClN3O2 — CID 142661459
1-(4-chlorophenyl)-1-methyl-3-[[4-(naphthalen-1-ylmethyl)morpholin-2-yl]methyl]urea (PubChem CID 142661459) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-methyl-3-[[4-(naphthalen-1-ylmethyl)morpholin-2-yl]methyl]urea.
| Compound Name | 1-(4-chlorophenyl)-1-methyl-3-[[4-(naphthalen-1-ylmethyl)morpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 142661459 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-(4-chlorophenyl)-1-methyl-3-[[4-(naphthalen-1-ylmethyl)morpholin-2-yl]methyl]urea |
| SMILES | CN(C(=O)NCC1CN(Cc2cccc3ccccc23)CCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26ClN3O2/c1-27(21-11-9-20(25)10-12-21)24(29)26-15-22-17-28(13-14-30-22)16-19-7-4-6-18-5-2-3-8-23(18)19/h2-12,22H,13-17H2,1H3,(H,26,29) |
| InChIKey | BWLRSWQGCNCTGP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |