C23H22N4O4S — CID 142664067
4-amino-N-[2-methyl-4-[(4S)-2-oxo-4-phenylimidazolidin-1-yl]sulfonylphenyl]benzamide (PubChem CID 142664067) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-amino-N-[2-methyl-4-[(4S)-2-oxo-4-phenylimidazolidin-1-yl]sulfonylphenyl]benzamide.
| Compound Name | 4-amino-N-[2-methyl-4-[(4S)-2-oxo-4-phenylimidazolidin-1-yl]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 142664067 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-amino-N-[2-methyl-4-[(4S)-2-oxo-4-phenylimidazolidin-1-yl]sulfonylphenyl]benzamide |
| SMILES | Cc1cc(S(=O)(=O)N2C[C@H](c3ccccc3)NC2=O)ccc1NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-15-13-19(11-12-20(15)25-22(28)17-7-9-18(24)10-8-17)32(30,31)27-14-21(26-23(27)29)16-5-3-2-4-6-16/h2-13,21H,14,24H2,1H3,(H,25,28)(H,26,29)/t21-/m1/s1 |
| InChIKey | JORUWUVZNMLSIR-OAQYLSRUSA-N |
| XLogP | 3.28 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|