C15H16ClNO3 — CID 142664189
methyl 2-(3-chloroprop-2-enyl)-4,7-dimethyl-3-oxo-1H-indole-2-carboxylate (PubChem CID 142664189) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is methyl 2-(3-chloroprop-2-enyl)-4,7-dimethyl-3-oxo-1H-indole-2-carboxylate.
| Compound Name | methyl 2-(3-chloroprop-2-enyl)-4,7-dimethyl-3-oxo-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142664189 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | methyl 2-(3-chloroprop-2-enyl)-4,7-dimethyl-3-oxo-1H-indole-2-carboxylate |
| SMILES | COC(=O)C1(CC=CCl)Nc2c(C)ccc(C)c2C1=O |
| InChI | InChI=1S/C15H16ClNO3/c1-9-5-6-10(2)12-11(9)13(18)15(17-12,7-4-8-16)14(19)20-3/h4-6,8,17H,7H2,1-3H3 |
| InChIKey | LXKYAQILTVTXKK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|