C13H12FNO3 — CID 142664213
methyl 6-fluoro-3-oxo-2-prop-2-enyl-1H-indole-2-carboxylate (PubChem CID 142664213) has the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. Its IUPAC name is methyl 6-fluoro-3-oxo-2-prop-2-enyl-1H-indole-2-carboxylate.
| Compound Name | methyl 6-fluoro-3-oxo-2-prop-2-enyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142664213 |
| Molecular Formula | C13H12FNO3 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | methyl 6-fluoro-3-oxo-2-prop-2-enyl-1H-indole-2-carboxylate |
| SMILES | C=CCC1(C(=O)OC)Nc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C13H12FNO3/c1-3-6-13(12(17)18-2)11(16)9-5-4-8(14)7-10(9)15-13/h3-5,7,15H,1,6H2,2H3 |
| InChIKey | ABOXYHUAGBCBIP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|