C15H18FNO — CID 177460445
2-butyl-5-fluoro-2-prop-2-enyl-1H-indol-3-one (PubChem CID 177460445) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is 2-butyl-5-fluoro-2-prop-2-enyl-1H-indol-3-one.
| Compound Name | 2-butyl-5-fluoro-2-prop-2-enyl-1H-indol-3-one |
|---|---|
| PubChem CID | 177460445 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-butyl-5-fluoro-2-prop-2-enyl-1H-indol-3-one |
| SMILES | C=CCC1(CCCC)Nc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C15H18FNO/c1-3-5-9-15(8-4-2)14(18)12-10-11(16)6-7-13(12)17-15/h4,6-7,10,17H,2-3,5,8-9H2,1H3 |
| InChIKey | GOLALTXTQBIADO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|