C19H22FNO2 — CID 51349402
6-fluoro-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione (PubChem CID 51349402) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 6-fluoro-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione.
| Compound Name | 6-fluoro-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 51349402 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 6-fluoro-3,3-bis(3-methylbut-2-enyl)-1H-quinoline-2,4-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)Nc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C19H22FNO2/c1-12(2)7-9-19(10-8-13(3)4)17(22)15-11-14(20)5-6-16(15)21-18(19)23/h5-8,11H,9-10H2,1-4H3,(H,21,23) |
| InChIKey | QDMKOAXKYGAISQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|