C9H4FN7O2 — CID 2786230
3,3-diazido-6-fluoro-1H-quinoline-2,4-dione (PubChem CID 2786230) has the molecular formula C9H4FN7O2 and a molecular weight of 261.18 g/mol. Its IUPAC name is 3,3-diazido-6-fluoro-1H-quinoline-2,4-dione.
| Compound Name | 3,3-diazido-6-fluoro-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 2786230 |
| Molecular Formula | C9H4FN7O2 |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 3,3-diazido-6-fluoro-1H-quinoline-2,4-dione |
| SMILES | [N-]=[N+]=NC1(N=[N+]=[N-])C(=O)Nc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C9H4FN7O2/c10-4-1-2-6-5(3-4)7(18)9(14-16-11,15-17-12)8(19)13-6/h1-3H,(H,13,19) |
| InChIKey | PEJUQHSFYIXUQK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|