C10H8FN5O2 — CID 176523965
1,1-diamino-N-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methylideneamino]methanimine oxide (PubChem CID 176523965) has the molecular formula C10H8FN5O2 and a molecular weight of 249.21 g/mol. Its IUPAC name is 1,1-diamino-N-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methylideneamino]methanimine oxide.
| Compound Name | 1,1-diamino-N-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methylideneamino]methanimine oxide |
|---|---|
| PubChem CID | 176523965 |
| Molecular Formula | C10H8FN5O2 |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 1,1-diamino-N-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methylideneamino]methanimine oxide |
| SMILES | NC(N)=[N+]([O-])N=C=C1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C10H8FN5O2/c11-5-1-2-8-6(3-5)7(9(17)15-8)4-14-16(18)10(12)13/h1-3H,12-13H2,(H,15,17) |
| InChIKey | FECLGHLMMWDQIX-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|