C9H7FN2O2 — CID 137234814
5-fluoro-3-methoxyimino-1H-indol-2-one (PubChem CID 137234814) has the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. Its IUPAC name is 5-fluoro-3-methoxyimino-1H-indol-2-one.
| Compound Name | 5-fluoro-3-methoxyimino-1H-indol-2-one |
|---|---|
| PubChem CID | 137234814 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 5-fluoro-3-methoxyimino-1H-indol-2-one |
| SMILES | CON=C1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C9H7FN2O2/c1-14-12-8-6-4-5(10)2-3-7(6)11-9(8)13/h2-4H,1H3,(H,11,12,13) |
| InChIKey | MTOALMKQZOFLML-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|