C17H9ClFN3O2 — CID 172921472
(3Z)-3-[(Z)-(6-chloro-2-oxo-3H-inden-1-ylidene)hydrazinylidene]-5-fluoro-1H-indol-2-one (PubChem CID 172921472) has the molecular formula C17H9ClFN3O2 and a molecular weight of 341.73 g/mol. Its IUPAC name is (3Z)-3-[(Z)-(6-chloro-2-oxo-3H-inden-1-ylidene)hydrazinylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | (3Z)-3-[(Z)-(6-chloro-2-oxo-3H-inden-1-ylidene)hydrazinylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 172921472 |
| Molecular Formula | C17H9ClFN3O2 |
| Molecular Weight | 341.73 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (3Z)-3-[(Z)-(6-chloro-2-oxo-3H-inden-1-ylidene)hydrazinylidene]-5-fluoro-1H-indol-2-one |
| SMILES | O=C1Cc2ccc(Cl)cc2/C1=N/N=C1\C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C17H9ClFN3O2/c18-9-2-1-8-5-14(23)15(11(8)6-9)21-22-16-12-7-10(19)3-4-13(12)20-17(16)24/h1-4,6-7H,5H2,(H,20,22,24)/b21-15- |
| InChIKey | OXEWLSNJSJRGPR-QNGOZBTKSA-N |
| XLogP | 2.75 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|