C27H29FN2O4S — CID 90738671
4,4-dibutyl-2-(7-ethenyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-7-fluoronaphthalene-1,3-dione (PubChem CID 90738671) has the molecular formula C27H29FN2O4S and a molecular weight of 496.60 g/mol. Its IUPAC name is 4,4-dibutyl-2-(7-ethenyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-7-fluoronaphthalene-1,3-dione.
| Compound Name | 4,4-dibutyl-2-(7-ethenyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-7-fluoronaphthalene-1,3-dione |
|---|---|
| PubChem CID | 90738671 |
| Molecular Formula | C27H29FN2O4S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4,4-dibutyl-2-(7-ethenyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-7-fluoronaphthalene-1,3-dione |
| SMILES | C=Cc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)c3cc(F)ccc3C(CCCC)(CCCC)C1=O)N2 |
| InChI | InChI=1S/C27H29FN2O4S/c1-4-7-13-27(14-8-5-2)20-11-10-18(28)16-19(20)24(31)23(25(27)32)26-29-21-12-9-17(6-3)15-22(21)35(33,34)30-26/h6,9-12,15-16,23H,3-5,7-8,13-14H2,1-2H3,(H,29,30) |
| InChIKey | HQZYEJWXNIMKTF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|