C27H32N2O4S — CID 11260176
2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-bis(3-methylbutyl)naphthalene-1,3-dione (PubChem CID 11260176) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-bis(3-methylbutyl)naphthalene-1,3-dione.
| Compound Name | 2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-bis(3-methylbutyl)naphthalene-1,3-dione |
|---|---|
| PubChem CID | 11260176 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-bis(3-methylbutyl)naphthalene-1,3-dione |
| SMILES | CC(C)CCC1(CCC(C)C)C(=O)C(C2=NS(=O)(=O)c3ccccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C27H32N2O4S/c1-17(2)13-15-27(16-14-18(3)4)20-10-6-5-9-19(20)24(30)23(25(27)31)26-28-21-11-7-8-12-22(21)34(32,33)29-26/h5-12,17-18,23H,13-16H2,1-4H3,(H,28,29) |
| InChIKey | RMBOCIHDISEFSJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|