C34H36N4O9S2 — CID 91069759
N-[3-[4-[acetyl(phenylmethoxy)amino]-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylsulfonylacetamide (PubChem CID 91069759) has the molecular formula C34H36N4O9S2 and a molecular weight of 708.82 g/mol. Its IUPAC name is N-[3-[4-[acetyl(phenylmethoxy)amino]-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylsulfonylacetamide.
| Compound Name | N-[3-[4-[acetyl(phenylmethoxy)amino]-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 91069759 |
| Molecular Formula | C34H36N4O9S2 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | N-[3-[4-[acetyl(phenylmethoxy)amino]-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylsulfonylacetamide |
| SMILES | CC(=O)N(OCc1ccccc1)C1(CCC(C)C)C(=O)C(C2=NS(=O)(=O)c3cc(N(C(C)=O)S(C)(=O)=O)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C34H36N4O9S2/c1-21(2)17-18-34(38(23(4)40)47-20-24-11-7-6-8-12-24)27-14-10-9-13-26(27)31(41)30(32(34)42)33-35-28-16-15-25(19-29(28)49(45,46)36-33)37(22(3)39)48(5,43)44/h6-16,19,21,30H,17-18,20H2,1-5H3,(H,35,36) |
| InChIKey | CXARZOJRHBFTKD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|