C31H32N4O7S2 — CID 11855096
N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]benzamide (PubChem CID 11855096) has the molecular formula C31H32N4O7S2 and a molecular weight of 636.75 g/mol. Its IUPAC name is N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]benzamide.
| Compound Name | N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 11855096 |
| Molecular Formula | C31H32N4O7S2 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]benzamide |
| SMILES | CC(C)(C)CCC1(NC(=O)c2ccccc2)C(=O)C(C2=NS(=O)(=O)c3cc(NS(C)(=O)=O)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C31H32N4O7S2/c1-30(2,3)16-17-31(33-29(38)19-10-6-5-7-11-19)22-13-9-8-12-21(22)26(36)25(27(31)37)28-32-23-15-14-20(34-43(4,39)40)18-24(23)44(41,42)35-28/h5-15,18,25,34H,16-17H2,1-4H3,(H,32,35)(H,33,38) |
| InChIKey | PQCDLJLSEQKNAL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 167.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|