C25H31N5O10S4 — CID 91613122
N'-[3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-2,4-dioxonaphthalen-1-yl]ethane-1,2-disulfonamide (PubChem CID 91613122) has the molecular formula C25H31N5O10S4 and a molecular weight of 689.82 g/mol. Its IUPAC name is N'-[3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-2,4-dioxonaphthalen-1-yl]ethane-1,2-disulfonamide.
| Compound Name | N'-[3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-2,4-dioxonaphthalen-1-yl]ethane-1,2-disulfonamide |
|---|---|
| PubChem CID | 91613122 |
| Molecular Formula | C25H31N5O10S4 |
| Molecular Weight | 689.82 g/mol |
| Exact Mass | 689.10 |
| IUPAC Name | N'-[3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-2,4-dioxonaphthalen-1-yl]ethane-1,2-disulfonamide |
| SMILES | CC(C)CCC1(NS(=O)(=O)CCS(N)(=O)=O)C(=O)C(C2=NS(=O)(=O)c3cc(NS(C)(=O)=O)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C25H31N5O10S4/c1-15(2)10-11-25(30-43(37,38)13-12-42(26,35)36)18-7-5-4-6-17(18)22(31)21(23(25)32)24-27-19-9-8-16(28-41(3,33)34)14-20(19)44(39,40)29-24/h4-9,14-15,21,28,30H,10-13H2,1-3H3,(H,27,29)(H2,26,35,36) |
| InChIKey | FCAFOVPYASPROG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 245.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.82 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|