C27H32N4O9S2 — CID 91501308
ethyl 2-[[3-[4-(hydroxyamino)-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-methylsulfonylamino]acetate (PubChem CID 91501308) has the molecular formula C27H32N4O9S2 and a molecular weight of 620.71 g/mol. Its IUPAC name is ethyl 2-[[3-[4-(hydroxyamino)-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-methylsulfonylamino]acetate.
| Compound Name | ethyl 2-[[3-[4-(hydroxyamino)-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-methylsulfonylamino]acetate |
|---|---|
| PubChem CID | 91501308 |
| Molecular Formula | C27H32N4O9S2 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | ethyl 2-[[3-[4-(hydroxyamino)-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-methylsulfonylamino]acetate |
| SMILES | CCOC(=O)CN(c1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)c3ccccc3C(CCC(C)C)(NO)C1=O)N2)S(C)(=O)=O |
| InChI | InChI=1S/C27H32N4O9S2/c1-5-40-22(32)15-31(41(4,36)37)17-10-11-20-21(14-17)42(38,39)29-26(28-20)23-24(33)18-8-6-7-9-19(18)27(30-35,25(23)34)13-12-16(2)3/h6-11,14,16,23,30,35H,5,12-13,15H2,1-4H3,(H,28,29) |
| InChIKey | HPXMUJHRHBSWRB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 188.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|