C25H29N3O3S — CID 90717912
(4R)-2-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3,3-dimethylbutyl)-4-methylnaphthalene-1,3-dione (PubChem CID 90717912) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is (4R)-2-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3,3-dimethylbutyl)-4-methylnaphthalene-1,3-dione.
| Compound Name | (4R)-2-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3,3-dimethylbutyl)-4-methylnaphthalene-1,3-dione |
|---|---|
| PubChem CID | 90717912 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (4R)-2-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(3,3-dimethylbutyl)-4-methylnaphthalene-1,3-dione |
| SMILES | C=S1(=O)N=C(C2C(=O)c3ccccc3[C@@](C)(CCC(C)(C)C)C2=O)Nc2ccc(N)cc21 |
| InChI | InChI=1S/C25H29N3O3S/c1-24(2,3)12-13-25(4)17-9-7-6-8-16(17)21(29)20(22(25)30)23-27-18-11-10-15(26)14-19(18)32(5,31)28-23/h6-11,14,20H,5,12-13,26H2,1-4H3,(H,27,28,31)/t20?,25-,32?/m1/s1 |
| InChIKey | PVULTPROVRGJLJ-DZRWQZIXSA-N |
| XLogP | 4.25 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|