C31H34N4O8S3 — CID 91457025
benzyl-[[3-[(4R)-4-(3,3-dimethylbutyl)-4-methyl-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methylsulfamoyl]carbamic acid (PubChem CID 91457025) has the molecular formula C31H34N4O8S3 and a molecular weight of 686.83 g/mol. Its IUPAC name is benzyl-[[3-[(4R)-4-(3,3-dimethylbutyl)-4-methyl-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methylsulfamoyl]carbamic acid.
| Compound Name | benzyl-[[3-[(4R)-4-(3,3-dimethylbutyl)-4-methyl-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methylsulfamoyl]carbamic acid |
|---|---|
| PubChem CID | 91457025 |
| Molecular Formula | C31H34N4O8S3 |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 686.15 |
| IUPAC Name | benzyl-[[3-[(4R)-4-(3,3-dimethylbutyl)-4-methyl-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methylsulfamoyl]carbamic acid |
| SMILES | CC(C)(C)CC[C@@]1(C)C(=O)C(C2=NS(=O)(=O)c3c(CNS(=O)(=O)N(Cc4ccccc4)C(=O)O)csc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C31H34N4O8S3/c1-30(2,3)14-15-31(4)22-13-9-8-12-21(22)24(36)23(26(31)37)27-33-28-25(45(40,41)34-27)20(18-44-28)16-32-46(42,43)35(29(38)39)17-19-10-6-5-7-11-19/h5-13,18,23,32H,14-17H2,1-4H3,(H,33,34)(H,38,39)/t23?,31-/m1/s1 |
| InChIKey | PBJZNQKSIUQECK-ORLYWQOISA-N |
| XLogP | 4.94 |
| TPSA | 179.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|