C33H36N4O7S2 — CID 11853314
N-benzyl-N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]acetamide (PubChem CID 11853314) has the molecular formula C33H36N4O7S2 and a molecular weight of 664.81 g/mol. Its IUPAC name is N-benzyl-N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]acetamide.
| Compound Name | N-benzyl-N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 11853314 |
| Molecular Formula | C33H36N4O7S2 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | N-benzyl-N-[1-(3,3-dimethylbutyl)-3-[7-(methanesulfonamido)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-2,4-dioxonaphthalen-1-yl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)C1(CCC(C)(C)C)C(=O)C(C2=NS(=O)(=O)c3cc(NS(C)(=O)=O)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C33H36N4O7S2/c1-21(38)37(20-22-11-7-6-8-12-22)33(18-17-32(2,3)4)25-14-10-9-13-24(25)29(39)28(30(33)40)31-34-26-16-15-23(35-45(5,41)42)19-27(26)46(43,44)36-31/h6-16,19,28,35H,17-18,20H2,1-5H3,(H,34,36) |
| InChIKey | XXQQDEGJBMMXGA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 159.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|