C20H19N3O6S2 — CID 90821062
N-[3-(4,4-dimethyl-1,3-dioxonaphthalen-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 90821062) has the molecular formula C20H19N3O6S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[3-(4,4-dimethyl-1,3-dioxonaphthalen-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-(4,4-dimethyl-1,3-dioxonaphthalen-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 90821062 |
| Molecular Formula | C20H19N3O6S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N-[3-(4,4-dimethyl-1,3-dioxonaphthalen-2-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CC1(C)C(=O)C(C2=NS(=O)(=O)c3cc(NS(C)(=O)=O)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H19N3O6S2/c1-20(2)13-7-5-4-6-12(13)17(24)16(18(20)25)19-21-14-9-8-11(22-30(3,26)27)10-15(14)31(28,29)23-19/h4-10,16,22H,1-3H3,(H,21,23) |
| InChIKey | LXKGNJRAHRQUOK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|