C21H23FN4O6S3 — CID 90962918
N-[[3-[5-ethyl-1-[(4-fluorophenyl)methyl]-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 90962918) has the molecular formula C21H23FN4O6S3 and a molecular weight of 542.64 g/mol. Its IUPAC name is N-[[3-[5-ethyl-1-[(4-fluorophenyl)methyl]-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[5-ethyl-1-[(4-fluorophenyl)methyl]-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 90962918 |
| Molecular Formula | C21H23FN4O6S3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | N-[[3-[5-ethyl-1-[(4-fluorophenyl)methyl]-2,4-dioxopiperidin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | CCC1CN(Cc2ccc(F)cc2)C(=O)C(C2=NS(=O)(=O)c3c(CNS(C)(=O)=O)csc3N2)C1=O |
| InChI | InChI=1S/C21H23FN4O6S3/c1-3-13-10-26(9-12-4-6-15(22)7-5-12)21(28)16(17(13)27)19-24-20-18(35(31,32)25-19)14(11-33-20)8-23-34(2,29)30/h4-7,11,13,16,23H,3,8-10H2,1-2H3,(H,24,25) |
| InChIKey | BUSWAADNHPFDSU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|