C22H23FN4O6S3 — CID 91281775
N-[[3-[1-[(4-fluorophenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 91281775) has the molecular formula C22H23FN4O6S3 and a molecular weight of 554.65 g/mol. Its IUPAC name is N-[[3-[1-[(4-fluorophenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[1-[(4-fluorophenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 91281775 |
| Molecular Formula | C22H23FN4O6S3 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-[[3-[1-[(4-fluorophenyl)methyl]-2,4-dioxo-5,6,7,7a-tetrahydro-4aH-cyclopenta[b]pyridin-3-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1csc2c1S(=O)(=O)N=C(C1C(=O)C3CCCC3N(Cc3ccc(F)cc3)C1=O)N2 |
| InChI | InChI=1S/C22H23FN4O6S3/c1-35(30,31)24-9-13-11-34-21-19(13)36(32,33)26-20(25-21)17-18(28)15-3-2-4-16(15)27(22(17)29)10-12-5-7-14(23)8-6-12/h5-8,11,15-17,24H,2-4,9-10H2,1H3,(H,25,26) |
| InChIKey | RYLNZXCATHNEAA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|