C26H27FN4O6S3 — CID 90866744
N-[[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]cyclopropanesulfonamide (PubChem CID 90866744) has the molecular formula C26H27FN4O6S3 and a molecular weight of 606.72 g/mol. Its IUPAC name is N-[[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]cyclopropanesulfonamide.
| Compound Name | N-[[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 90866744 |
| Molecular Formula | C26H27FN4O6S3 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | N-[[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]cyclopropanesulfonamide |
| SMILES | O=C1C(C2=NS(=O)(=O)c3c(CNS(=O)(=O)C4CC4)csc3N2)C(=O)N(Cc2ccc(F)cc2)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C26H27FN4O6S3/c27-17-5-1-13(2-6-17)11-31-21-15-4-3-14(9-15)19(21)22(32)20(26(31)33)24-29-25-23(40(36,37)30-24)16(12-38-25)10-28-39(34,35)18-7-8-18/h1-2,5-6,12,14-15,18-21,28H,3-4,7-11H2,(H,29,30)/t14-,15+,19+,20?,21-/m0/s1 |
| InChIKey | GBHHTTDJUOLROJ-OMMXQNFUSA-N |
| XLogP | 2.62 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|