C29H26FN5O6S2 — CID 90750511
N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]pyridine-3-sulfonamide (PubChem CID 90750511) has the molecular formula C29H26FN5O6S2 and a molecular weight of 623.69 g/mol. Its IUPAC name is N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]pyridine-3-sulfonamide.
| Compound Name | N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 90750511 |
| Molecular Formula | C29H26FN5O6S2 |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]pyridine-3-sulfonamide |
| SMILES | O=C1C(C2=NS(=O)(=O)c3cc(NS(=O)(=O)c4cccnc4)ccc3N2)C(=O)N(Cc2ccc(F)cc2)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C29H26FN5O6S2/c30-19-7-3-16(4-8-19)15-35-26-18-6-5-17(12-18)24(26)27(36)25(29(35)37)28-32-22-10-9-20(13-23(22)43(40,41)34-28)33-42(38,39)21-2-1-11-31-14-21/h1-4,7-11,13-14,17-18,24-26,33H,5-6,12,15H2,(H,32,34)/t17-,18+,24+,25?,26-/m0/s1 |
| InChIKey | JVYAZBTXHWIQIP-PRSNIRLPSA-N |
| XLogP | 3.18 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|