C23H24N4O6S3 — CID 90794313
N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 90794313) has the molecular formula C23H24N4O6S3 and a molecular weight of 548.67 g/mol. Its IUPAC name is N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 90794313 |
| Molecular Formula | C23H24N4O6S3 |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3N(Cc3ccsc3)C1=O)N2 |
| InChI | InChI=1S/C23H24N4O6S3/c1-35(30,31)25-15-4-5-16-17(9-15)36(32,33)26-22(24-16)19-21(28)18-13-2-3-14(8-13)20(18)27(23(19)29)10-12-6-7-34-11-12/h4-7,9,11,13-14,18-20,25H,2-3,8,10H2,1H3,(H,24,26)/t13-,14+,18+,19?,20-/m0/s1 |
| InChIKey | VKOJGRIFPHBXRL-YBGBOCQCSA-N |
| XLogP | 2.27 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|