C23H25F3N4O6S2 — CID 91054574
N-[3-[(1S,2S,7R,8R)-4,6-dioxo-3-[[1-(trifluoromethyl)cyclopropyl]methyl]-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 91054574) has the molecular formula C23H25F3N4O6S2 and a molecular weight of 574.60 g/mol. Its IUPAC name is N-[3-[(1S,2S,7R,8R)-4,6-dioxo-3-[[1-(trifluoromethyl)cyclopropyl]methyl]-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1S,2S,7R,8R)-4,6-dioxo-3-[[1-(trifluoromethyl)cyclopropyl]methyl]-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 91054574 |
| Molecular Formula | C23H25F3N4O6S2 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | N-[3-[(1S,2S,7R,8R)-4,6-dioxo-3-[[1-(trifluoromethyl)cyclopropyl]methyl]-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)[C@@H]3[C@@H]4CC[C@@H](C4)[C@@H]3N(CC3(C(F)(F)F)CC3)C1=O)N2 |
| InChI | InChI=1S/C23H25F3N4O6S2/c1-37(33,34)28-13-4-5-14-15(9-13)38(35,36)29-20(27-14)17-19(31)16-11-2-3-12(8-11)18(16)30(21(17)32)10-22(6-7-22)23(24,25)26/h4-5,9,11-12,16-18,28H,2-3,6-8,10H2,1H3,(H,27,29)/t11-,12+,16-,17?,18+/m1/s1 |
| InChIKey | IBUPZIAMVOBYPC-SISYONGVSA-N |
| XLogP | 2.36 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|