C18H20N4O6S2 — CID 91461345
N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 91461345) has the molecular formula C18H20N4O6S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 91461345 |
| Molecular Formula | C18H20N4O6S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[3-[(1R,2S,7R,8S)-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)N[C@H]3[C@@H]4CC[C@@H](C4)[C@H]3C1=O)N2 |
| InChI | InChI=1S/C18H20N4O6S2/c1-29(25,26)21-10-4-5-11-12(7-10)30(27,28)22-17(19-11)14-16(23)13-8-2-3-9(6-8)15(13)20-18(14)24/h4-5,7-9,13-15,21H,2-3,6H2,1H3,(H,19,22)(H,20,24)/t8-,9+,13+,14?,15-/m0/s1 |
| InChIKey | KRQHUZJEMKCQEY-RUXQWFGESA-N |
| XLogP | 0.30 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|