C26H27FN4O5S2 — CID 91397878
N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 91397878) has the molecular formula C26H27FN4O5S2 and a molecular weight of 558.66 g/mol. Its IUPAC name is N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 91397878 |
| Molecular Formula | C26H27FN4O5S2 |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | N-[3-[(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | C=S1(=O)N=C(C2C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3N(Cc3ccc(F)cc3)C2=O)Nc2ccc(NS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C26H27FN4O5S2/c1-37(34)20-12-18(29-38(2,35)36)9-10-19(20)28-25(30-37)22-24(32)21-15-5-6-16(11-15)23(21)31(26(22)33)13-14-3-7-17(27)8-4-14/h3-4,7-10,12,15-16,21-23,29H,1,5-6,11,13H2,2H3,(H,28,30,34)/t15-,16+,21+,22?,23-,37?/m0/s1 |
| InChIKey | XGXVMEGUULZOSD-OISOVIMSSA-N |
| XLogP | 2.65 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|