C26H28N4O6S2 — CID 91291443
N-[3-(3-benzyl-4,6-dioxo-3-azatricyclo[6.2.2.02,7]dodecan-5-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 91291443) has the molecular formula C26H28N4O6S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is N-[3-(3-benzyl-4,6-dioxo-3-azatricyclo[6.2.2.02,7]dodecan-5-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-(3-benzyl-4,6-dioxo-3-azatricyclo[6.2.2.02,7]dodecan-5-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 91291443 |
| Molecular Formula | C26H28N4O6S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-[3-(3-benzyl-4,6-dioxo-3-azatricyclo[6.2.2.02,7]dodecan-5-yl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)C3C4CCC(CC4)C3N(Cc3ccccc3)C1=O)N2 |
| InChI | InChI=1S/C26H28N4O6S2/c1-37(33,34)28-18-11-12-19-20(13-18)38(35,36)29-25(27-19)22-24(31)21-16-7-9-17(10-8-16)23(21)30(26(22)32)14-15-5-3-2-4-6-15/h2-6,11-13,16-17,21-23,28H,7-10,14H2,1H3,(H,27,29) |
| InChIKey | ZPGMTYCNDGTBSV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|