C28H25FN4O6S2 — CID 71470375
N-[3-[(1R,10S)-11-[(4-fluorophenyl)methyl]-12,14-dioxo-11-azahexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradecan-13-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 71470375) has the molecular formula C28H25FN4O6S2 and a molecular weight of 596.66 g/mol. Its IUPAC name is N-[3-[(1R,10S)-11-[(4-fluorophenyl)methyl]-12,14-dioxo-11-azahexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradecan-13-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,10S)-11-[(4-fluorophenyl)methyl]-12,14-dioxo-11-azahexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradecan-13-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 71470375 |
| Molecular Formula | C28H25FN4O6S2 |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | N-[3-[(1R,10S)-11-[(4-fluorophenyl)methyl]-12,14-dioxo-11-azahexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradecan-13-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)[C@@H]3C4C5C6C7C5C(C7C64)[C@@H]3N(Cc3ccc(F)cc3)C1=O)N2 |
| InChI | InChI=1S/C28H25FN4O6S2/c1-40(36,37)31-12-6-7-13-14(8-12)41(38,39)32-27(30-13)24-26(34)23-21-17-15-16-19(17)22(20(16)18(15)21)25(23)33(28(24)35)9-10-2-4-11(29)5-3-10/h2-8,15-25,31H,9H2,1H3,(H,30,32)/t15?,16?,17?,18?,19?,20?,21?,22?,23-,24?,25+/m1/s1 |
| InChIKey | ZHGBGXWJJUAHLX-QRBRVVLJSA-N |
| XLogP | 1.92 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|