C23H22FN5O6S2 — CID 91303743
N-[3-[(1S,3R)-7-[(4-fluorophenyl)methyl]-8,10-dioxo-6,7-diazatricyclo[4.4.0.01,3]decan-9-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 91303743) has the molecular formula C23H22FN5O6S2 and a molecular weight of 547.59 g/mol. Its IUPAC name is N-[3-[(1S,3R)-7-[(4-fluorophenyl)methyl]-8,10-dioxo-6,7-diazatricyclo[4.4.0.01,3]decan-9-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1S,3R)-7-[(4-fluorophenyl)methyl]-8,10-dioxo-6,7-diazatricyclo[4.4.0.01,3]decan-9-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 91303743 |
| Molecular Formula | C23H22FN5O6S2 |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | N-[3-[(1S,3R)-7-[(4-fluorophenyl)methyl]-8,10-dioxo-6,7-diazatricyclo[4.4.0.01,3]decan-9-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)N(Cc3ccc(F)cc3)N3CC[C@@H]4C[C@@]43C1=O)N2 |
| InChI | InChI=1S/C23H22FN5O6S2/c1-36(32,33)26-16-6-7-17-18(10-16)37(34,35)27-21(25-17)19-20(30)23-11-14(23)8-9-29(23)28(22(19)31)12-13-2-4-15(24)5-3-13/h2-7,10,14,19,26H,8-9,11-12H2,1H3,(H,25,27)/t14-,19?,23+/m1/s1 |
| InChIKey | HEYYWOWXANVTGJ-RHHIFJNSSA-N |
| XLogP | 1.32 |
| TPSA | 145.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|