C26H26ClFN4O6S2 — CID 90791759
N-[3-[3-[(2-chloro-4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 90791759) has the molecular formula C26H26ClFN4O6S2 and a molecular weight of 609.10 g/mol. Its IUPAC name is N-[3-[3-[(2-chloro-4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[3-[(2-chloro-4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 90791759 |
| Molecular Formula | C26H26ClFN4O6S2 |
| Molecular Weight | 609.10 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | N-[3-[3-[(2-chloro-4-fluorophenyl)methyl]-2-methyl-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CC12C3CCC(C3)C1C(=O)C(C1=NS(=O)(=O)c3cc(NS(C)(=O)=O)ccc3N1)C(=O)N2Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C26H26ClFN4O6S2/c1-26-15-5-3-13(9-15)22(26)23(33)21(25(34)32(26)12-14-4-6-16(28)10-18(14)27)24-29-19-8-7-17(30-39(2,35)36)11-20(19)40(37,38)31-24/h4,6-8,10-11,13,15,21-22,30H,3,5,9,12H2,1-2H3,(H,29,31) |
| InChIKey | UPPAFOYLYMWCTG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.10 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|