C25H24ClFN4O6S2 — CID 90811711
N-[3-[(1R,2S,7R,8S)-3-[(2-chloro-4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 90811711) has the molecular formula C25H24ClFN4O6S2 and a molecular weight of 595.07 g/mol. Its IUPAC name is N-[3-[(1R,2S,7R,8S)-3-[(2-chloro-4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,2S,7R,8S)-3-[(2-chloro-4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 90811711 |
| Molecular Formula | C25H24ClFN4O6S2 |
| Molecular Weight | 595.07 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | N-[3-[(1R,2S,7R,8S)-3-[(2-chloro-4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3N(Cc3ccc(F)cc3Cl)C1=O)N2 |
| InChI | InChI=1S/C25H24ClFN4O6S2/c1-38(34,35)29-16-6-7-18-19(10-16)39(36,37)30-24(28-18)21-23(32)20-12-2-3-13(8-12)22(20)31(25(21)33)11-14-4-5-15(27)9-17(14)26/h4-7,9-10,12-13,20-22,29H,2-3,8,11H2,1H3,(H,28,30)/t12-,13+,20+,21?,22-/m0/s1 |
| InChIKey | VDPATFMIQNUWDV-IKCVGYCOSA-N |
| XLogP | 3.01 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|