C26H26F2N4O6S2 — CID 91439328
N-[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylmethanesulfonamide (PubChem CID 91439328) has the molecular formula C26H26F2N4O6S2 and a molecular weight of 592.65 g/mol. Its IUPAC name is N-[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 91439328 |
| Molecular Formula | C26H26F2N4O6S2 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | N-[3-[(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]-N-methylmethanesulfonamide |
| SMILES | CN(c1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3N(Cc3ccc(F)c(F)c3)C1=O)N2)S(C)(=O)=O |
| InChI | InChI=1S/C26H26F2N4O6S2/c1-31(39(2,35)36)16-6-8-19-20(11-16)40(37,38)30-25(29-19)22-24(33)21-14-4-5-15(10-14)23(21)32(26(22)34)12-13-3-7-17(27)18(28)9-13/h3,6-9,11,14-15,21-23H,4-5,10,12H2,1-2H3,(H,29,30)/t14-,15+,21+,22?,23-/m0/s1 |
| InChIKey | JJHFALCPCMDADS-IPMPXODQSA-N |
| XLogP | 2.52 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|